C20H24N5O6PS — CID 14102464
6-[8-benzylsulfanyl-6-(propylamino)purin-9-yl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 14102464) has the molecular formula C20H24N5O6PS and a molecular weight of 493.48 g/mol. Its IUPAC name is 6-[8-benzylsulfanyl-6-(propylamino)purin-9-yl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | 6-[8-benzylsulfanyl-6-(propylamino)purin-9-yl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 14102464 |
| Molecular Formula | C20H24N5O6PS |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 6-[8-benzylsulfanyl-6-(propylamino)purin-9-yl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | CCCNc1ncnc2c1nc(SCc1ccccc1)n2C1OC2COP(=O)(O)OC2C1O |
| InChI | InChI=1S/C20H24N5O6PS/c1-2-8-21-17-14-18(23-11-22-17)25(20(24-14)33-10-12-6-4-3-5-7-12)19-15(26)16-13(30-19)9-29-32(27,28)31-16/h3-7,11,13,15-16,19,26H,2,8-10H2,1H3,(H,27,28)(H,21,22,23) |
| InChIKey | FYLLNWMLEYUACV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|