C18H28BN7O6P+ — CID 90086095
CID 90086095 (PubChem CID 90086095) has the molecular formula C18H28BN7O6P+ and a molecular weight of 480.25 g/mol.
| Compound Name | CID 90086095 |
|---|---|
| PubChem CID | 90086095 |
| Molecular Formula | C18H28BN7O6P+ |
| Molecular Weight | 480.25 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(OC(=O)NCCCCCCNC)[C@H]2O1 |
| InChI | InChI=1S/C18H28BN7O6P/c1-21-6-4-2-3-5-7-22-18(27)31-14-13-11(8-29-33(19,28)32-13)30-17(14)26-10-25-12-15(20)23-9-24-16(12)26/h9-11,13-14,17,21,28H,2-8H2,1H3,(H,22,27)(H2,20,23,24)/q+1/t11-,13+,14?,17-,33?/m1/s1 |
| InChIKey | NLHKUNSQBMSGMH-HGICAJIDSA-N |
| XLogP | 0.43 |
| TPSA | 167.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|