C11H14N5O5P — CID 123649206
6-(2-amino-6-methoxypurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 123649206) has the molecular formula C11H14N5O5P and a molecular weight of 327.24 g/mol. Its IUPAC name is 6-(2-amino-6-methoxypurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | 6-(2-amino-6-methoxypurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 123649206 |
| Molecular Formula | C11H14N5O5P |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 6-(2-amino-6-methoxypurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | COc1nc(N)nc2c1ncn2C1OC2COPOC2C1O |
| InChI | InChI=1S/C11H14N5O5P/c1-18-9-5-8(14-11(12)15-9)16(3-13-5)10-6(17)7-4(20-10)2-19-22-21-7/h3-4,6-7,10,17,22H,2H2,1H3,(H2,12,14,15) |
| InChIKey | WNZIVWCVLCYBGA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|