C16H23N6O5P — CID 123622114
9-[2-(cyclobutylamino)-7-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine (PubChem CID 123622114) has the molecular formula C16H23N6O5P and a molecular weight of 410.37 g/mol. Its IUPAC name is 9-[2-(cyclobutylamino)-7-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine.
| Compound Name | 9-[2-(cyclobutylamino)-7-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 123622114 |
| Molecular Formula | C16H23N6O5P |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 9-[2-(cyclobutylamino)-7-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2C1OC2COP(=O)(NC3CCC3)OC2C1C |
| InChI | InChI=1S/C16H23N6O5P/c1-8-12-10(6-25-28(23,27-12)21-9-4-3-5-9)26-15(8)22-7-18-11-13(22)19-16(17)20-14(11)24-2/h7-10,12,15H,3-6H2,1-2H3,(H,21,23)(H2,17,19,20) |
| InChIKey | UCONIOFHKCPPLG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|