C16H22N7O5P — CID 163516244
9-[(4aR,6R,7R,7aS)-2-(cyclopropylamino)-7-methyl-7-(methylideneamino)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine (PubChem CID 163516244) has the molecular formula C16H22N7O5P and a molecular weight of 423.37 g/mol. Its IUPAC name is 9-[(4aR,6R,7R,7aS)-2-(cyclopropylamino)-7-methyl-7-(methylideneamino)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine.
| Compound Name | 9-[(4aR,6R,7R,7aS)-2-(cyclopropylamino)-7-methyl-7-(methylideneamino)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 163516244 |
| Molecular Formula | C16H22N7O5P |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 9-[(4aR,6R,7R,7aS)-2-(cyclopropylamino)-7-methyl-7-(methylideneamino)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine |
| SMILES | C=N[C@]1(C)[C@@H]2OP(=O)(NC3CC3)OC[C@H]2O[C@H]1n1cnc2c(OC)nc(N)nc21 |
| InChI | InChI=1S/C16H22N7O5P/c1-16(18-2)11-9(6-26-29(24,28-11)22-8-4-5-8)27-14(16)23-7-19-10-12(23)20-15(17)21-13(10)25-3/h7-9,11,14H,2,4-6H2,1,3H3,(H,22,24)(H2,17,20,21)/t9-,11-,14-,16-,29?/m1/s1 |
| InChIKey | DGZPPERTNGMMJL-UYISCHNFSA-N |
| XLogP | 1.05 |
| TPSA | 148.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|