C21H32FN6O7P — CID 118311530
[(2S)-2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]butyl] 2-methylpropanoate (PubChem CID 118311530) has the molecular formula C21H32FN6O7P and a molecular weight of 530.49 g/mol. Its IUPAC name is [(2S)-2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]butyl] 2-methylpropanoate.
| Compound Name | [(2S)-2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]butyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 118311530 |
| Molecular Formula | C21H32FN6O7P |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [(2S)-2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]butyl] 2-methylpropanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(N[C@@H](CC)COC(=O)C(C)C)O[C@H]2[C@@]1(C)F |
| InChI | InChI=1S/C21H32FN6O7P/c1-6-12(8-32-18(29)11(3)4)27-36(30)33-9-13-15(35-36)21(5,22)19(34-13)28-10-24-14-16(28)25-20(23)26-17(14)31-7-2/h10-13,15,19H,6-9H2,1-5H3,(H,27,30)(H2,23,25,26)/t12-,13+,15+,19+,21+,36?/m0/s1 |
| InChIKey | AZYJXSBOJAHEGU-HRHYRMOFSA-N |
| XLogP | 2.52 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|