C23H36ClN6O7P — CID 123752513
[2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3,3-dimethylbutyl] 2-methylpropanoate (PubChem CID 123752513) has the molecular formula C23H36ClN6O7P and a molecular weight of 575.00 g/mol. Its IUPAC name is [2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3,3-dimethylbutyl] 2-methylpropanoate.
| Compound Name | [2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3,3-dimethylbutyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 123752513 |
| Molecular Formula | C23H36ClN6O7P |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3,3-dimethylbutyl] 2-methylpropanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)(NC(COC(=O)C(C)C)C(C)(C)C)O[C@H]2[C@@]1(C)Cl |
| InChI | InChI=1S/C23H36ClN6O7P/c1-8-33-18-15-17(27-21(25)28-18)30(11-26-15)20-23(7,24)16-13(36-20)9-35-38(32,37-16)29-14(22(4,5)6)10-34-19(31)12(2)3/h11-14,16,20H,8-10H2,1-7H3,(H,29,32)(H2,25,27,28)/t13-,14?,16-,20-,23-,38-/m1/s1 |
| InChIKey | BDFZDKYYZUGCOQ-BWAZEHMBSA-N |
| XLogP | 3.43 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|