C20H29ClN5O8PS — CID 118966204
S-[2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 118966204) has the molecular formula C20H29ClN5O8PS and a molecular weight of 565.97 g/mol. Its IUPAC name is S-[2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 118966204 |
| Molecular Formula | C20H29ClN5O8PS |
| Molecular Weight | 565.97 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | S-[2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)(OCCSC(=O)C(C)(C)CO)O[C@H]2[C@@]1(C)Cl |
| InChI | InChI=1S/C20H29ClN5O8PS/c1-5-30-15-12-14(24-18(22)25-15)26(10-23-12)16-20(4,21)13-11(33-16)8-32-35(29,34-13)31-6-7-36-17(28)19(2,3)9-27/h10-11,13,16,27H,5-9H2,1-4H3,(H2,22,24,25)/t11-,13-,16-,20-,35+/m1/s1 |
| InChIKey | SWCVWDQLJSJPHC-JGLGVRKGSA-N |
| XLogP | 2.52 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.97 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|