C19H30N5O7PS2 — CID 118983187
(2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-2-[2-(tert-butyldisulfanyl)ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 118983187) has the molecular formula C19H30N5O7PS2 and a molecular weight of 535.59 g/mol. Its IUPAC name is (2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-2-[2-(tert-butyldisulfanyl)ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-2-[2-(tert-butyldisulfanyl)ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 118983187 |
| Molecular Formula | C19H30N5O7PS2 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | (2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-2-[2-(tert-butyldisulfanyl)ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@@](=O)(OCCSSC(C)(C)C)O[C@H]2[C@@]1(C)O |
| InChI | InChI=1S/C19H30N5O7PS2/c1-6-27-15-12-14(22-17(20)23-15)24(10-21-12)16-19(5,25)13-11(30-16)9-29-32(26,31-13)28-7-8-33-34-18(2,3)4/h10-11,13,16,25H,6-9H2,1-5H3,(H2,20,22,23)/t11-,13-,16-,19-,32-/m1/s1 |
| InChIKey | DNPIBIXJYHHSHS-NEPUOUQKSA-N |
| XLogP | 3.18 |
| TPSA | 153.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|