C23H28N5O9P — CID 123286109
ethyl 2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-phenylacetate (PubChem CID 123286109) has the molecular formula C23H28N5O9P and a molecular weight of 549.48 g/mol. Its IUPAC name is ethyl 2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-phenylacetate.
| Compound Name | ethyl 2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-phenylacetate |
|---|---|
| PubChem CID | 123286109 |
| Molecular Formula | C23H28N5O9P |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | ethyl 2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-phenylacetate |
| SMILES | CCOC(=O)C(OP1(=O)OCC2OC(n3cnc4c(OCC)nc(N)nc43)C(C)(O)C2O1)c1ccccc1 |
| InChI | InChI=1S/C23H28N5O9P/c1-4-32-19-15-18(26-22(24)27-19)28(12-25-15)21-23(3,30)17-14(35-21)11-34-38(31,37-17)36-16(20(29)33-5-2)13-9-7-6-8-10-13/h6-10,12,14,16-17,21,30H,4-5,11H2,1-3H3,(H2,24,26,27) |
| InChIKey | SPTQRNUKRGLGDV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 179.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|