C16H24N5O6PS — CID 57411543
(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-methyl-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 57411543) has the molecular formula C16H24N5O6PS and a molecular weight of 445.44 g/mol. Its IUPAC name is (4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-methyl-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-methyl-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 57411543 |
| Molecular Formula | C16H24N5O6PS |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-methyl-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=S)(OC(C)C)O[C@H]2[C@@]1(C)O |
| InChI | InChI=1S/C16H24N5O6PS/c1-5-23-13-10-12(19-15(17)20-13)21(7-18-10)14-16(4,22)11-9(25-14)6-24-28(29,27-11)26-8(2)3/h7-9,11,14,22H,5-6H2,1-4H3,(H2,17,19,20)/t9-,11-,14-,16-,28?/m1/s1 |
| InChIKey | KSQKANSLDCYHDU-ZUTBUJIFSA-N |
| XLogP | 1.52 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|