C15H20Cl2N5O5PS — CID 118125730
9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-ethoxypurin-2-amine (PubChem CID 118125730) has the molecular formula C15H20Cl2N5O5PS and a molecular weight of 484.30 g/mol. Its IUPAC name is 9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-ethoxypurin-2-amine.
| Compound Name | 9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-ethoxypurin-2-amine |
|---|---|
| PubChem CID | 118125730 |
| Molecular Formula | C15H20Cl2N5O5PS |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-ethoxypurin-2-amine |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=S)(OC(C)C)O[C@H]2C1(Cl)Cl |
| InChI | InChI=1S/C15H20Cl2N5O5PS/c1-4-23-12-9-11(20-14(18)21-12)22(6-19-9)13-15(16,17)10-8(25-13)5-24-28(29,27-10)26-7(2)3/h6-8,10,13H,4-5H2,1-3H3,(H2,18,20,21)/t8-,10-,13-,28+/m1/s1 |
| InChIKey | JWYNQPLFTPZWIK-ALCHNCBHSA-N |
| XLogP | 2.94 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|