C12H15Cl2N5O4 — CID 123846486
5-(2-amino-6-ethoxypurin-9-yl)-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 123846486) has the molecular formula C12H15Cl2N5O4 and a molecular weight of 364.19 g/mol. Its IUPAC name is 5-(2-amino-6-ethoxypurin-9-yl)-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 5-(2-amino-6-ethoxypurin-9-yl)-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 123846486 |
| Molecular Formula | C12H15Cl2N5O4 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 5-(2-amino-6-ethoxypurin-9-yl)-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCOc1nc(N)nc2c1ncn2C1OC(CO)C(O)C1(Cl)Cl |
| InChI | InChI=1S/C12H15Cl2N5O4/c1-2-22-9-6-8(17-11(15)18-9)19(4-16-6)10-12(13,14)7(21)5(3-20)23-10/h4-5,7,10,20-21H,2-3H2,1H3,(H2,15,17,18) |
| InChIKey | AGFWPPCSVBNMCJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|