C11H13Br2N5O4 — CID 154011880
(2R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dibromo-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 154011880) has the molecular formula C11H13Br2N5O4 and a molecular weight of 439.06 g/mol. Its IUPAC name is (2R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dibromo-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dibromo-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 154011880 |
| Molecular Formula | C11H13Br2N5O4 |
| Molecular Weight | 439.06 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | (2R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dibromo-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)C(O)C1(Br)Br |
| InChI | InChI=1S/C11H13Br2N5O4/c1-21-8-5-7(16-10(14)17-8)18(3-15-5)9-11(12,13)6(20)4(2-19)22-9/h3-4,6,9,19-20H,2H2,1H3,(H2,14,16,17)/t4-,6?,9-/m1/s1 |
| InChIKey | RMOKJHPIFPUBHO-WZASZJOBSA-N |
| XLogP | 0.15 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.06 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|