C12H17N5O5 — CID 148902630
(2R,5R,6R)-2-(2-amino-6-methoxypurin-9-yl)-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 148902630) has the molecular formula C12H17N5O5 and a molecular weight of 311.30 g/mol. Its IUPAC name is (2R,5R,6R)-2-(2-amino-6-methoxypurin-9-yl)-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,5R,6R)-2-(2-amino-6-methoxypurin-9-yl)-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 148902630 |
| Molecular Formula | C12H17N5O5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2R,5R,6R)-2-(2-amino-6-methoxypurin-9-yl)-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)[C@H](O)CC1O |
| InChI | InChI=1S/C12H17N5O5/c1-21-10-8-9(15-12(13)16-10)17(4-14-8)11-6(20)2-5(19)7(3-18)22-11/h4-7,11,18-20H,2-3H2,1H3,(H2,13,15,16)/t5-,6?,7-,11-/m1/s1 |
| InChIKey | PHCBHBQLNUWCMB-MRYPEJKBSA-N |
| XLogP | -1.58 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |