C13H18FN5O5 — CID 90085246
(2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolane-3,3-diol (PubChem CID 90085246) has the molecular formula C13H18FN5O5 and a molecular weight of 343.32 g/mol. Its IUPAC name is (2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolane-3,3-diol.
| Compound Name | (2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolane-3,3-diol |
|---|---|
| PubChem CID | 90085246 |
| Molecular Formula | C13H18FN5O5 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolane-3,3-diol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)C(O)(O)[C@@]1(C)F |
| InChI | InChI=1S/C13H18FN5O5/c1-3-23-9-7-8(17-11(15)18-9)19(5-16-7)10-12(2,14)13(21,22)6(4-20)24-10/h5-6,10,20-22H,3-4H2,1-2H3,(H2,15,17,18)/t6-,10-,12+/m1/s1 |
| InChIKey | DZNVTICUAJNDNP-CXTDYRRUSA-N |
| XLogP | -0.89 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|