C15H20FN5O3 — CID 123287501
[5-(2-amino-6-ethoxypurin-9-yl)-3-ethenyl-4-fluoro-4-methyloxolan-2-yl]methanol (PubChem CID 123287501) has the molecular formula C15H20FN5O3 and a molecular weight of 337.36 g/mol. Its IUPAC name is [5-(2-amino-6-ethoxypurin-9-yl)-3-ethenyl-4-fluoro-4-methyloxolan-2-yl]methanol.
| Compound Name | [5-(2-amino-6-ethoxypurin-9-yl)-3-ethenyl-4-fluoro-4-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 123287501 |
| Molecular Formula | C15H20FN5O3 |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [5-(2-amino-6-ethoxypurin-9-yl)-3-ethenyl-4-fluoro-4-methyloxolan-2-yl]methanol |
| SMILES | C=CC1C(CO)OC(n2cnc3c(OCC)nc(N)nc32)C1(C)F |
| InChI | InChI=1S/C15H20FN5O3/c1-4-8-9(6-22)24-13(15(8,3)16)21-7-18-10-11(21)19-14(17)20-12(10)23-5-2/h4,7-9,13,22H,1,5-6H2,2-3H3,(H2,17,19,20) |
| InChIKey | QXCPAMXNNKPGDM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|