C18H26FN6O7P — CID 90285110
2-[[(2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutanoic acid (PubChem CID 90285110) has the molecular formula C18H26FN6O7P and a molecular weight of 488.41 g/mol. Its IUPAC name is 2-[[(2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90285110 |
| Molecular Formula | C18H26FN6O7P |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[[(2S,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutanoic acid |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@@](=O)(NC(C(=O)O)C(C)C)O[C@H]2[C@@]1(C)F |
| InChI | InChI=1S/C18H26FN6O7P/c1-5-29-14-11-13(22-17(20)23-14)25(7-21-11)16-18(4,19)12-9(31-16)6-30-33(28,32-12)24-10(8(2)3)15(26)27/h7-10,12,16H,5-6H2,1-4H3,(H,24,28)(H,26,27)(H2,20,22,23)/t9-,10?,12-,16-,18-,33+/m1/s1 |
| InChIKey | JEPQDGLXWPXKHF-VLWLUUKFSA-N |
| XLogP | 1.66 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|