C13H16Cl2N5O4PS — CID 118125715
9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-amine (PubChem CID 118125715) has the molecular formula C13H16Cl2N5O4PS and a molecular weight of 440.25 g/mol. Its IUPAC name is 9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-amine.
| Compound Name | 9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-amine |
|---|---|
| PubChem CID | 118125715 |
| Molecular Formula | C13H16Cl2N5O4PS |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 9-[(2S,4aR,6R,7aR)-7,7-dichloro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-amine |
| SMILES | CC(C)O[P@@]1(=S)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(Cl)(Cl)[C@@H]2O1 |
| InChI | InChI=1S/C13H16Cl2N5O4PS/c1-6(2)23-25(26)21-3-7-9(24-25)13(14,15)12(22-7)20-5-19-8-10(16)17-4-18-11(8)20/h4-7,9,12H,3H2,1-2H3,(H2,16,17,18)/t7-,9-,12-,25+/m1/s1 |
| InChIKey | SVZJEHSQOWLAQZ-UBBBUTIGSA-N |
| XLogP | 2.54 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|