C10H11N5O5P- — CID 171320783
9-(2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine (PubChem CID 171320783) has the molecular formula C10H11N5O5P- and a molecular weight of 312.20 g/mol. Its IUPAC name is 9-(2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine.
| Compound Name | 9-(2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine |
|---|---|
| PubChem CID | 171320783 |
| Molecular Formula | C10H11N5O5P- |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 9-(2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1CC2OP(=O)([O-])OCC2O1 |
| InChI | InChI=1S/C10H12N5O5P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5-6(19-7)2-18-21(16,17)20-5/h3-7H,1-2H2,(H,16,17)(H2,11,12,13)/p-1 |
| InChIKey | MKMZAENVDZADSW-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|