C22H21N5O3Sn — CID 125125739
9-[(4aR,6S,7aR)-2,2-diphenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxastannin-6-yl]purin-6-amine (PubChem CID 125125739) has the molecular formula C22H21N5O3Sn and a molecular weight of 522.15 g/mol. Its IUPAC name is 9-[(4aR,6S,7aR)-2,2-diphenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxastannin-6-yl]purin-6-amine.
| Compound Name | 9-[(4aR,6S,7aR)-2,2-diphenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxastannin-6-yl]purin-6-amine |
|---|---|
| PubChem CID | 125125739 |
| Molecular Formula | C22H21N5O3Sn |
| Molecular Weight | 522.15 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 9-[(4aR,6S,7aR)-2,2-diphenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxastannin-6-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C[C@H]2O[Sn](c3ccccc3)(c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C10H11N5O3.2C6H5.Sn/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7;2*1-2-4-6-5-3-1;/h3-7H,1-2H2,(H2,11,12,13);2*1-5H;/q-2;;;+2/t5-,6-,7+;;;/m1.../s1 |
| InChIKey | ZRKMLPQXPCPPBB-YNDMERRNSA-N |
| XLogP | 1.37 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |