C10H12N6O3 — CID 20844825
5-(6-aminopurin-9-yl)-2-[(E)-hydroxyiminomethyl]oxolan-3-ol (PubChem CID 20844825) has the molecular formula C10H12N6O3 and a molecular weight of 264.25 g/mol. Its IUPAC name is 5-(6-aminopurin-9-yl)-2-[(E)-hydroxyiminomethyl]oxolan-3-ol.
| Compound Name | 5-(6-aminopurin-9-yl)-2-[(E)-hydroxyiminomethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 20844825 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-(6-aminopurin-9-yl)-2-[(E)-hydroxyiminomethyl]oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(/C=N/O)O1 |
| InChI | InChI=1S/C10H12N6O3/c11-9-8-10(13-3-12-9)16(4-14-8)7-1-5(17)6(19-7)2-15-18/h2-7,17-18H,1H2,(H2,11,12,13)/b15-2+ |
| InChIKey | MJNPXASWULCQTA-RSSMCMFDSA-N |
| XLogP | -0.48 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|