C15H23N7O2 — CID 10958553
(2R,3S,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)oxolan-3-ol (PubChem CID 10958553) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is (2R,3S,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 10958553 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R,3S,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)oxolan-3-ol |
| SMILES | CN(C/C=C\CN)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C15H23N7O2/c1-21(5-3-2-4-16)7-11-10(23)6-12(24-11)22-9-20-13-14(17)18-8-19-15(13)22/h2-3,8-12,23H,4-7,16H2,1H3,(H2,17,18,19)/b3-2-/t10-,11+,12+/m0/s1 |
| InChIKey | WJXVWCZSTHQCKL-YFXGRDGWSA-N |
| XLogP | -0.50 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|