C15H22FN7O2 — CID 25141776
(2R,3R,4R,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol (PubChem CID 25141776) has the molecular formula C15H22FN7O2 and a molecular weight of 351.39 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 25141776 |
| Molecular Formula | C15H22FN7O2 |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2R,3R,4R,5R)-2-[[[(Z)-4-aminobut-2-enyl]-methylamino]methyl]-5-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol |
| SMILES | CN(C/C=C\CN)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C15H22FN7O2/c1-22(5-3-2-4-17)6-9-12(24)10(16)15(25-9)23-8-21-11-13(18)19-7-20-14(11)23/h2-3,7-10,12,15,24H,4-6,17H2,1H3,(H2,18,19,20)/b3-2-/t9-,10-,12-,15-/m1/s1 |
| InChIKey | NPGZZLCILZSYOC-KJUCIFOFSA-N |
| XLogP | -0.55 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|