C16H25N7O3 — CID 57021952
(2R,5R)-2-[[4-aminobut-2-enyl(ethyl)amino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 57021952) has the molecular formula C16H25N7O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is (2R,5R)-2-[[4-aminobut-2-enyl(ethyl)amino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[[4-aminobut-2-enyl(ethyl)amino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57021952 |
| Molecular Formula | C16H25N7O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (2R,5R)-2-[[4-aminobut-2-enyl(ethyl)amino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | CCN(CC=CCN)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C16H25N7O3/c1-2-22(6-4-3-5-17)7-10-12(24)13(25)16(26-10)23-9-21-11-14(18)19-8-20-15(11)23/h3-4,8-10,12-13,16,24-25H,2,5-7,17H2,1H3,(H2,18,19,20)/t10-,12?,13?,16-/m1/s1 |
| InChIKey | DKMOTLIIHKDGMV-VHBSBENZSA-N |
| XLogP | -1.14 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|