C13H19N5O — CID 58159383
9-[(2R,5R)-4,5-diethyloxolan-2-yl]purin-6-amine (PubChem CID 58159383) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 9-[(2R,5R)-4,5-diethyloxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-4,5-diethyloxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 58159383 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 9-[(2R,5R)-4,5-diethyloxolan-2-yl]purin-6-amine |
| SMILES | CCC1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CC |
| InChI | InChI=1S/C13H19N5O/c1-3-8-5-10(19-9(8)4-2)18-7-17-11-12(14)15-6-16-13(11)18/h6-10H,3-5H2,1-2H3,(H2,14,15,16)/t8?,9-,10-/m1/s1 |
| InChIKey | SLGHMRLMPBLAGX-VXRWAFEHSA-N |
| XLogP | 2.13 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |