C18H20N6O4 — CID 58520501
9-[(2R,5R)-5-ethyl-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]purin-6-amine (PubChem CID 58520501) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 9-[(2R,5R)-5-ethyl-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-5-ethyl-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 58520501 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 9-[(2R,5R)-5-ethyl-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]purin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)CC1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N6O4/c1-2-13-14(27-8-11-5-3-4-6-12(11)24(25)26)7-15(28-13)23-10-22-16-17(19)20-9-21-18(16)23/h3-6,9-10,13-15H,2,7-8H2,1H3,(H2,19,20,21)/t13-,14?,15-/m1/s1 |
| InChIKey | WFIIJEMGYRFCHB-GIJJTGMTSA-N |
| XLogP | 2.60 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|