C24H32N10O10P2S-2 — CID 58369781
[(2R,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphoryl]oxymethyl]oxolan-3-yl] 3-sulfanylpropyl phosphate (PubChem CID 58369781) has the molecular formula C24H32N10O10P2S-2 and a molecular weight of 714.59 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphoryl]oxymethyl]oxolan-3-yl] 3-sulfanylpropyl phosphate.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphoryl]oxymethyl]oxolan-3-yl] 3-sulfanylpropyl phosphate |
|---|---|
| PubChem CID | 58369781 |
| Molecular Formula | C24H32N10O10P2S-2 |
| Molecular Weight | 714.59 g/mol |
| Exact Mass | 714.15 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-[[[(2R,5R)-5-(6-aminopurin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphoryl]oxymethyl]oxolan-3-yl] 3-sulfanylpropyl phosphate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)CC1OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)CC1OP(=O)([O-])OCCCS |
| InChI | InChI=1S/C24H34N10O10P2S/c1-2-13-14(6-17(41-13)33-11-31-19-21(25)27-9-29-23(19)33)43-46(37,38)40-8-16-15(44-45(35,36)39-4-3-5-47)7-18(42-16)34-12-32-20-22(26)28-10-30-24(20)34/h9-18,47H,2-8H2,1H3,(H,35,36)(H,37,38)(H2,25,27,29)(H2,26,28,30)/p-2/t13-,14?,15?,16-,17-,18-/m1/s1 |
| InChIKey | XVEBDTFQIKHODX-HHSAHOSWSA-L |
| XLogP | 0.88 |
| TPSA | 274.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.59 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|