C18H23N6O15P3 — CID 87827636
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[2-(2-nitrophenyl)ethoxy]phosphoryl] hydrogen phosphate (PubChem CID 87827636) has the molecular formula C18H23N6O15P3 and a molecular weight of 656.33 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[2-(2-nitrophenyl)ethoxy]phosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[2-(2-nitrophenyl)ethoxy]phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87827636 |
| Molecular Formula | C18H23N6O15P3 |
| Molecular Weight | 656.33 g/mol |
| Exact Mass | 656.04 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[2-(2-nitrophenyl)ethoxy]phosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OCCc2ccccc2[N+](=O)[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H23N6O15P3/c19-16-13-17(21-8-20-16)23(9-22-13)18-15(26)14(25)12(37-18)7-36-41(31,32)39-42(33,34)38-40(29,30)35-6-5-10-3-1-2-4-11(10)24(27)28/h1-4,8-9,12,14-15,18,25-26H,5-7H2,(H,29,30)(H,31,32)(H,33,34)(H2,19,20,21)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | YJPWOFMSDJOAJL-SCFUHWHPSA-N |
| XLogP | 0.55 |
| TPSA | 311.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|