C10H11N5O — CID 10584868
9-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]purin-6-amine (PubChem CID 10584868) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 9-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]purin-6-amine.
| Compound Name | 9-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 10584868 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 9-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C10H11N5O/c11-9-7-10(13-3-12-9)15(4-14-7)5-1-2-6-8(5)16-6/h3-6,8H,1-2H2,(H2,11,12,13)/t5-,6-,8+/m0/s1 |
| InChIKey | IDNRZERZHNBYQI-VMHSAVOQSA-N |
| XLogP | 0.51 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|