C18H19N5O3 — CID 10713051
9-[(2R,4aR,8S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]purin-6-amine (PubChem CID 10713051) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 9-[(2R,4aR,8S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]purin-6-amine.
| Compound Name | 9-[(2R,4aR,8S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]purin-6-amine |
|---|---|
| PubChem CID | 10713051 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 9-[(2R,4aR,8S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CCO[C@@H]2CO[C@@H](c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C18H19N5O3/c19-16-14-17(21-9-20-16)23(10-22-14)12-6-7-24-13-8-25-18(26-15(12)13)11-4-2-1-3-5-11/h1-5,9-10,12-13,15,18H,6-8H2,(H2,19,20,21)/t12-,13+,15-,18+/m0/s1 |
| InChIKey | RROHVRJVJKLJQH-SCGCMHLBSA-N |
| XLogP | 1.85 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |