C18H19N5O4 — CID 10571103
(2R,4aR,7S,8S,8aS)-8-(6-aminopurin-9-yl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 10571103) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is (2R,4aR,7S,8S,8aS)-8-(6-aminopurin-9-yl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2R,4aR,7S,8S,8aS)-8-(6-aminopurin-9-yl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 10571103 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2R,4aR,7S,8S,8aS)-8-(6-aminopurin-9-yl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1[C@@H]2O[C@H](c3ccccc3)OC[C@H]2OC[C@H]1O |
| InChI | InChI=1S/C18H19N5O4/c19-16-13-17(21-8-20-16)23(9-22-13)14-11(24)6-25-12-7-26-18(27-15(12)14)10-4-2-1-3-5-10/h1-5,8-9,11-12,14-15,18,24H,6-7H2,(H2,19,20,21)/t11-,12-,14+,15-,18-/m1/s1 |
| InChIKey | USGNGTOCFGLTFE-YYTKTWKHSA-N |
| XLogP | 0.82 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |