C11H15Cl2N5O3 — CID 23209333
3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;dihydrochloride (PubChem CID 23209333) has the molecular formula C11H15Cl2N5O3 and a molecular weight of 336.18 g/mol. Its IUPAC name is 3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;dihydrochloride.
| Compound Name | 3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;dihydrochloride |
|---|---|
| PubChem CID | 23209333 |
| Molecular Formula | C11H15Cl2N5O3 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ncnc2c1ncn2C1COC2C(O)COC21 |
| InChI | InChI=1S/C11H13N5O3.2ClH/c12-10-7-11(14-3-13-10)16(4-15-7)5-1-18-9-6(17)2-19-8(5)9;;/h3-6,8-9,17H,1-2H2,(H2,12,13,14);2*1H |
| InChIKey | PTCSLWKLBTWXOP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |