C10H11N5O2 — CID 10752094
(3S,6R)-6-(6-aminopurin-9-yl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 10752094) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is (3S,6R)-6-(6-aminopurin-9-yl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (3S,6R)-6-(6-aminopurin-9-yl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 10752094 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (3S,6R)-6-(6-aminopurin-9-yl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C=C[C@H](O)CO1 |
| InChI | InChI=1S/C10H11N5O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(16)3-17-7/h1-2,4-7,16H,3H2,(H2,11,12,13)/t6-,7+/m0/s1 |
| InChIKey | ZFBNRRJNAKLBTB-NKWVEPMBSA-N |
| XLogP | -0.15 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|