C11H13N5O2S — CID 59901097
(3S,3aR,6R,6aS)-3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-thiol (PubChem CID 59901097) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is (3S,3aR,6R,6aS)-3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-thiol.
| Compound Name | (3S,3aR,6R,6aS)-3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-thiol |
|---|---|
| PubChem CID | 59901097 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (3S,3aR,6R,6aS)-3-(6-aminopurin-9-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-thiol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CO[C@H]2[C@@H]1OC[C@H]2S |
| InChI | InChI=1S/C11H13N5O2S/c12-10-7-11(14-3-13-10)16(4-15-7)5-1-17-9-6(19)2-18-8(5)9/h3-6,8-9,19H,1-2H2,(H2,12,13,14)/t5-,6+,8+,9+/m0/s1 |
| InChIKey | LZQCROYPLWDYLE-HIORRCEOSA-N |
| XLogP | 0.05 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|