C11H14FN5O3 — CID 11460257
(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxan-3-ol (PubChem CID 11460257) has the molecular formula C11H14FN5O3 and a molecular weight of 283.26 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 11460257 |
| Molecular Formula | C11H14FN5O3 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1CO[C@H](CO)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C11H14FN5O3/c12-7-5(2-20-6(1-18)9(7)19)17-4-16-8-10(13)14-3-15-11(8)17/h3-7,9,18-19H,1-2H2,(H2,13,14,15)/t5-,6-,7+,9-/m1/s1 |
| InChIKey | MMXBWFAVKUUELR-JAGXHNFQSA-N |
| XLogP | -0.96 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |