C16H17N5O2 — CID 10638769
9-[(3R,4S)-4-phenylmethoxyoxolan-3-yl]purin-6-amine (PubChem CID 10638769) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 9-[(3R,4S)-4-phenylmethoxyoxolan-3-yl]purin-6-amine.
| Compound Name | 9-[(3R,4S)-4-phenylmethoxyoxolan-3-yl]purin-6-amine |
|---|---|
| PubChem CID | 10638769 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 9-[(3R,4S)-4-phenylmethoxyoxolan-3-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1COC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H17N5O2/c17-15-14-16(19-9-18-15)21(10-20-14)12-7-22-8-13(12)23-6-11-4-2-1-3-5-11/h1-5,9-10,12-13H,6-8H2,(H2,17,18,19)/t12-,13-/m1/s1 |
| InChIKey | XUNRIEDTMAAACH-CHWSQXEVSA-N |
| XLogP | 1.57 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |