C26H28N6O5 — CID 134460357
2-[[5-(6-aminopurin-9-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methylamino]acetic acid (PubChem CID 134460357) has the molecular formula C26H28N6O5 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-[[5-(6-aminopurin-9-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methylamino]acetic acid.
| Compound Name | 2-[[5-(6-aminopurin-9-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methylamino]acetic acid |
|---|---|
| PubChem CID | 134460357 |
| Molecular Formula | C26H28N6O5 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-[[5-(6-aminopurin-9-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methylamino]acetic acid |
| SMILES | Nc1ncnc2c1ncn2C1OC(CNCC(=O)O)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N6O5/c27-24-21-25(30-15-29-24)32(16-31-21)26-23(36-14-18-9-5-2-6-10-18)22(19(37-26)11-28-12-20(33)34)35-13-17-7-3-1-4-8-17/h1-10,15-16,19,22-23,26,28H,11-14H2,(H,33,34)(H2,27,29,30) |
| InChIKey | XPPRCLZVPJYSFW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |