C40H39N5O6 — CID 146028016
(2R,4R,5S,6S,7R)-2-(6-aminopurin-9-yl)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)oxepan-3-one (PubChem CID 146028016) has the molecular formula C40H39N5O6 and a molecular weight of 685.78 g/mol. Its IUPAC name is (2R,4R,5S,6S,7R)-2-(6-aminopurin-9-yl)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)oxepan-3-one.
| Compound Name | (2R,4R,5S,6S,7R)-2-(6-aminopurin-9-yl)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)oxepan-3-one |
|---|---|
| PubChem CID | 146028016 |
| Molecular Formula | C40H39N5O6 |
| Molecular Weight | 685.78 g/mol |
| Exact Mass | 685.29 |
| IUPAC Name | (2R,4R,5S,6S,7R)-2-(6-aminopurin-9-yl)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)oxepan-3-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1=O |
| InChI | InChI=1S/C40H39N5O6/c41-38-33-39(43-26-42-38)45(27-44-33)40-34(46)36(49-23-30-17-9-3-10-18-30)37(50-24-31-19-11-4-12-20-31)35(48-22-29-15-7-2-8-16-29)32(51-40)25-47-21-28-13-5-1-6-14-28/h1-20,26-27,32,35-37,40H,21-25H2,(H2,41,42,43)/t32-,35+,36+,37+,40-/m1/s1 |
| InChIKey | MARIDKPHBJFMNO-DKUAUWFASA-N |
| XLogP | 5.85 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.78 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |