C17H18N5O6S- — CID 161404053
4-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate (PubChem CID 161404053) has the molecular formula C17H18N5O6S- and a molecular weight of 420.43 g/mol. Its IUPAC name is 4-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate.
| Compound Name | 4-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate |
|---|---|
| PubChem CID | 161404053 |
| Molecular Formula | C17H18N5O6S- |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC(COCc2ccc(S(=O)[O-])cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H19N5O6S/c18-15-12-16(20-7-19-15)22(8-21-12)17-14(24)13(23)11(28-17)6-27-5-9-1-3-10(4-2-9)29(25)26/h1-4,7-8,11,13-14,17,23-24H,5-6H2,(H,25,26)(H2,18,19,20)/p-1/t11?,13-,14-,17-/m1/s1 |
| InChIKey | PQCIYSSMIFRMID-LZLKQYFISA-M |
| XLogP | -0.52 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|