C17H18N5O6SY- — CID 58701491
4-[[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate;yttrium (PubChem CID 58701491) has the molecular formula C17H18N5O6SY- and a molecular weight of 509.33 g/mol. Its IUPAC name is 4-[[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate;yttrium.
| Compound Name | 4-[[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate;yttrium |
|---|---|
| PubChem CID | 58701491 |
| Molecular Formula | C17H18N5O6SY- |
| Molecular Weight | 509.33 g/mol |
| Exact Mass | 509.00 |
| IUPAC Name | 4-[[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzenesulfinate;yttrium |
| SMILES | Nc1ncnc2c1ncn2C1O[C@H](COCc2ccc(S(=O)[O-])cc2)[C@@H](O)[C@H]1O.[Y] |
| InChI | InChI=1S/C17H19N5O6S.Y/c18-15-12-16(20-7-19-15)22(8-21-12)17-14(24)13(23)11(28-17)6-27-5-9-1-3-10(4-2-9)29(25)26;/h1-4,7-8,11,13-14,17,23-24H,5-6H2,(H,25,26)(H2,18,19,20);/p-1/t11-,13-,14-,17?;/m1./s1 |
| InChIKey | QAYIQNIZFZJECH-GFFDYJJASA-M |
| XLogP | -0.52 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|