C19H23N5O7 — CID 70869469
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methoxymethyl]oxolane-3,4-diol (PubChem CID 70869469) has the molecular formula C19H23N5O7 and a molecular weight of 433.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methoxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methoxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70869469 |
| Molecular Formula | C19H23N5O7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methoxymethyl]oxolane-3,4-diol |
| SMILES | COc1cc(COC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C19H23N5O7/c1-28-10-3-9(4-11(29-2)14(10)25)5-30-6-12-15(26)16(27)19(31-12)24-8-23-13-17(20)21-7-22-18(13)24/h3-4,7-8,12,15-16,19,25-27H,5-6H2,1-2H3,(H2,20,21,22)/t12-,15-,16-,19-/m1/s1 |
| InChIKey | IAMSQCXJJPEFBB-BGIGGGFGSA-N |
| XLogP | -0.03 |
| TPSA | 167.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |