C25H27N5O3 — CID 10433651
[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-bis(phenylmethoxy)cyclopentyl]methanol (PubChem CID 10433651) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-bis(phenylmethoxy)cyclopentyl]methanol.
| Compound Name | [(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-bis(phenylmethoxy)cyclopentyl]methanol |
|---|---|
| PubChem CID | 10433651 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-bis(phenylmethoxy)cyclopentyl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C[C@H](CO)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H27N5O3/c26-24-21-25(28-15-27-24)30(16-29-21)20-11-19(12-31)22(32-13-17-7-3-1-4-8-17)23(20)33-14-18-9-5-2-6-10-18/h1-10,15-16,19-20,22-23,31H,11-14H2,(H2,26,27,28)/t19-,20-,22-,23-/m1/s1 |
| InChIKey | WNRFNXPPYCBRRI-OHUMZHCVSA-N |
| XLogP | 3.13 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |