C19H21N5O — CID 10042585
9-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purin-6-amine (PubChem CID 10042585) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 9-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purin-6-amine.
| Compound Name | 9-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purin-6-amine |
|---|---|
| PubChem CID | 10042585 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 9-[(1S,2S,5S)-5-(phenylmethoxymethyl)-2-bicyclo[3.1.0]hexanyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@]2(COCc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C19H21N5O/c20-17-16-18(22-11-21-17)24(12-23-16)15-6-7-19(8-14(15)19)10-25-9-13-4-2-1-3-5-13/h1-5,11-12,14-15H,6-10H2,(H2,20,21,22)/t14-,15+,19-/m1/s1 |
| InChIKey | ZOSUWNROQNHBAI-ZRGWGRIASA-N |
| XLogP | 2.97 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |