C27H32N5O7P — CID 155096118
[(2R,3R)-5-(6-aminopurin-9-yl)-3,4-dimethoxy-2-methyloxolan-2-yl]methyl dibenzyl phosphate (PubChem CID 155096118) has the molecular formula C27H32N5O7P and a molecular weight of 569.56 g/mol. Its IUPAC name is [(2R,3R)-5-(6-aminopurin-9-yl)-3,4-dimethoxy-2-methyloxolan-2-yl]methyl dibenzyl phosphate.
| Compound Name | [(2R,3R)-5-(6-aminopurin-9-yl)-3,4-dimethoxy-2-methyloxolan-2-yl]methyl dibenzyl phosphate |
|---|---|
| PubChem CID | 155096118 |
| Molecular Formula | C27H32N5O7P |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | [(2R,3R)-5-(6-aminopurin-9-yl)-3,4-dimethoxy-2-methyloxolan-2-yl]methyl dibenzyl phosphate |
| SMILES | COC1C(n2cnc3c(N)ncnc32)O[C@](C)(COP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H]1OC |
| InChI | InChI=1S/C27H32N5O7P/c1-27(23(35-3)22(34-2)26(39-27)32-18-31-21-24(28)29-17-30-25(21)32)16-38-40(33,36-14-19-10-6-4-7-11-19)37-15-20-12-8-5-9-13-20/h4-13,17-18,22-23,26H,14-16H2,1-3H3,(H2,28,29,30)/t22?,23-,26?,27-/m1/s1 |
| InChIKey | LONPUQFGEVUBPN-FWSNFORSSA-N |
| XLogP | 4.28 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|