C38H39N5O9P2 — CID 10509405
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-bis(phenylmethoxy)phosphoryloxy-5-methyloxolan-3-yl] dibenzyl phosphate (PubChem CID 10509405) has the molecular formula C38H39N5O9P2 and a molecular weight of 771.70 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-bis(phenylmethoxy)phosphoryloxy-5-methyloxolan-3-yl] dibenzyl phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-bis(phenylmethoxy)phosphoryloxy-5-methyloxolan-3-yl] dibenzyl phosphate |
|---|---|
| PubChem CID | 10509405 |
| Molecular Formula | C38H39N5O9P2 |
| Molecular Weight | 771.70 g/mol |
| Exact Mass | 771.22 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-bis(phenylmethoxy)phosphoryloxy-5-methyloxolan-3-yl] dibenzyl phosphate |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H]1OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H39N5O9P2/c1-28-34(51-53(44,46-22-29-14-6-2-7-15-29)47-23-30-16-8-3-9-17-30)35(38(50-28)43-27-42-33-36(39)40-26-41-37(33)43)52-54(45,48-24-31-18-10-4-11-19-31)49-25-32-20-12-5-13-21-32/h2-21,26-28,34-35,38H,22-25H2,1H3,(H2,39,40,41)/t28-,34-,35-,38-/m1/s1 |
| InChIKey | ZQCPMOJVFVXJFF-MJGFWXCTSA-N |
| XLogP | 8.18 |
| TPSA | 168.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|