C11H15N5Na3O15P3-6 — CID 170453417
trisodium;5-(6-aminopurin-9-yl)-4-methoxy-2-methyloxolan-3-ol;triphosphate (PubChem CID 170453417) has the molecular formula C11H15N5Na3O15P3-6 and a molecular weight of 619.15 g/mol. Its IUPAC name is trisodium;5-(6-aminopurin-9-yl)-4-methoxy-2-methyloxolan-3-ol;triphosphate.
| Compound Name | trisodium;5-(6-aminopurin-9-yl)-4-methoxy-2-methyloxolan-3-ol;triphosphate |
|---|---|
| PubChem CID | 170453417 |
| Molecular Formula | C11H15N5Na3O15P3-6 |
| Molecular Weight | 619.15 g/mol |
| Exact Mass | 618.95 |
| IUPAC Name | trisodium;5-(6-aminopurin-9-yl)-4-methoxy-2-methyloxolan-3-ol;triphosphate |
| SMILES | COC1C(O)C(C)OC1n1cnc2c(N)ncnc21.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C11H15N5O3.3Na.3H3O4P/c1-5-7(17)8(18-2)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16;;;;3*1-5(2,3)4/h3-5,7-8,11,17H,1-2H3,(H2,12,13,14);;;;3*(H3,1,2,3,4)/q;3*+1;;;/p-9 |
| InChIKey | HLKMYYIAORUKKZ-UHFFFAOYSA-E |
| XLogP | -17.76 |
| TPSA | 367.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.15 |
| LogP ≤ 5 | -17.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|