C29H33N5O2 — CID 71511975
9-[(R)-[(1R,2S,5R)-2,5-dimethyl-1-(phenylmethoxymethyl)cyclohex-3-en-1-yl]-phenylmethoxymethyl]purin-6-amine (PubChem CID 71511975) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 9-[(R)-[(1R,2S,5R)-2,5-dimethyl-1-(phenylmethoxymethyl)cyclohex-3-en-1-yl]-phenylmethoxymethyl]purin-6-amine.
| Compound Name | 9-[(R)-[(1R,2S,5R)-2,5-dimethyl-1-(phenylmethoxymethyl)cyclohex-3-en-1-yl]-phenylmethoxymethyl]purin-6-amine |
|---|---|
| PubChem CID | 71511975 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 9-[(R)-[(1R,2S,5R)-2,5-dimethyl-1-(phenylmethoxymethyl)cyclohex-3-en-1-yl]-phenylmethoxymethyl]purin-6-amine |
| SMILES | C[C@H]1C=C[C@H](C)[C@](COCc2ccccc2)([C@@H](OCc2ccccc2)n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C29H33N5O2/c1-21-13-14-22(2)29(15-21,18-35-16-23-9-5-3-6-10-23)28(36-17-24-11-7-4-8-12-24)34-20-33-25-26(30)31-19-32-27(25)34/h3-14,19-22,28H,15-18H2,1-2H3,(H2,30,31,32)/t21-,22-,28+,29-/m0/s1 |
| InChIKey | AYVPKVWDWPKFML-RGTUZWOVSA-N |
| XLogP | 5.56 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|