C24H25N5O — CID 22880551
9-[(2R,3S)-1-(3-ethenylphenyl)-3-phenylmethoxybutan-2-yl]purin-6-amine (PubChem CID 22880551) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 9-[(2R,3S)-1-(3-ethenylphenyl)-3-phenylmethoxybutan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3S)-1-(3-ethenylphenyl)-3-phenylmethoxybutan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 22880551 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 9-[(2R,3S)-1-(3-ethenylphenyl)-3-phenylmethoxybutan-2-yl]purin-6-amine |
| SMILES | C=Cc1cccc(C[C@H]([C@H](C)OCc2ccccc2)n2cnc3c(N)ncnc32)c1 |
| InChI | InChI=1S/C24H25N5O/c1-3-18-10-7-11-20(12-18)13-21(17(2)30-14-19-8-5-4-6-9-19)29-16-28-22-23(25)26-15-27-24(22)29/h3-12,15-17,21H,1,13-14H2,2H3,(H2,25,26,27)/t17-,21+/m0/s1 |
| InChIKey | NJUVNKKOFHDNAX-LAUBAEHRSA-N |
| XLogP | 4.44 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |