C31H41N5O3Si — CID 69305722
[3-(6-aminopurin-9-yl)-4-[tert-butyl(diphenyl)silyl]oxypentyl] 2,2-dimethylpropanoate (PubChem CID 69305722) has the molecular formula C31H41N5O3Si and a molecular weight of 559.79 g/mol. Its IUPAC name is [3-(6-aminopurin-9-yl)-4-[tert-butyl(diphenyl)silyl]oxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [3-(6-aminopurin-9-yl)-4-[tert-butyl(diphenyl)silyl]oxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 69305722 |
| Molecular Formula | C31H41N5O3Si |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | [3-(6-aminopurin-9-yl)-4-[tert-butyl(diphenyl)silyl]oxypentyl] 2,2-dimethylpropanoate |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CCOC(=O)C(C)(C)C)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C31H41N5O3Si/c1-22(39-40(31(5,6)7,23-14-10-8-11-15-23)24-16-12-9-13-17-24)25(18-19-38-29(37)30(2,3)4)36-21-35-26-27(32)33-20-34-28(26)36/h8-17,20-22,25H,18-19H2,1-7H3,(H2,32,33,34) |
| InChIKey | IQGASDOAMNBLKV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|